Skip to content

Derivatives

The derivative of ff at x=ax = a is defined as:

Derivatives and Tangent Lines

Adjust the parameters in the graph above to explore the relationships between variables.

F(a)=limh0f(a+h)f(a)hF'(a) = \lim_{h \to 0} \frac{f(a+h) - f(a)}{h}

Equivalently, using an alternate form:

F(a)=limxaf(x)f(a)xaF'(a) = \lim_{x \to a} \frac{f(x) - f(a)}{x - a}

If this limit exists, ff is said to be differentiable at aa.

Physical intuition. If s(t)s(t) is position at time ttThen s(t)s'(t) is the instantaneous Velocity. The derivative answers: “how fast is ff changing right now?”

Geometric intuition. The derivative f(a)f'(a) equals the slope of the tangent line to the graph of ff at the point (a,f(a))(a, f(a)).

  • Geometric: f(a)f'(a) is the slope of the tangent line to y=f(x)y = f(x) at the point (a,f(a))(a, f(a)).
  • Physical: If s(t)s(t) is position, then s(t)s'(t) is instantaneous velocity.
  • Rate of change: f(a)f'(a) gives the instantaneous rate of change of ff with respect to xx at x=ax = a.

Example

Find f(2)f'(2) for f(x)=x23x+1f(x) = x^2 - 3x + 1 using the limit definition.

F(2)=limh0f(2+h)f(2)h=limh0(2+h)23(2+h)+1(1)hF'(2) = \lim_{h \to 0} \frac{f(2+h) - f(2)}{h} = \lim_{h \to 0} \frac{(2+h)^2 - 3(2+h) + 1 - (-1)}{h}=limh04+4h+h263h+1+1h=limh0h2+hh=limh0(h+1)=1= \lim_{h \to 0} \frac{4 + 4h + h^2 - 6 - 3h + 1 + 1}{h} = \lim_{h \to 0} \frac{h^2 + h}{h} = \lim_{h \to 0}(h + 1) = 1

Example

Find f(x)f'(x) for f(x)=1xf(x) = \frac{1}{x} using the limit definition.

F(x)=limh01x+h1xh=limh0x(x+h)hx(x+h)=limh0hhx(x+h)=limh01x(x+h)=1x2F'(x) = \lim_{h \to 0} \frac{\frac{1}{x+h} - \frac{1}{x}}{h} = \lim_{h \to 0} \frac{x - (x+h)}{h \cdot x(x+h)} = \lim_{h \to 0} \frac{-h}{h \cdot x(x+h)} = \lim_{h \to 0} \frac{-1}{x(x+h)} = -\frac{1}{x^2}

Example

Find f(x)f'(x) for f(x)=xf(x) = \sqrt{x} using the limit definition.

F(x)=limh0x+hxhF'(x) = \lim_{h \to 0} \frac{\sqrt{x+h} - \sqrt{x}}{h}

Multiply numerator and denominator by x+h+x\sqrt{x+h} + \sqrt{x}:

=limh0x+hxh(x+h+x)=limh01x+h+x=12x= \lim_{h \to 0} \frac{x + h - x}{h(\sqrt{x+h} + \sqrt{x})} = \lim_{h \to 0} \frac{1}{\sqrt{x+h} + \sqrt{x}} = \frac{1}{2\sqrt{x}}

This confirms the power rule for n=12n = \frac{1}{2}: ddx[x1/2]=12x1/2=12x\frac{d}{dx}[x^{1/2}] = \frac{1}{2}x^{-1/2} = \frac{1}{2\sqrt{x}}. \blacksquare

Theorem. If ff is differentiable at aaThen ff is continuous at aa.

Proof. We need to show limxaf(x)=f(a)\displaystyle\lim_{x \to a} f(x) = f(a). Consider:

limxa[f(x)f(a)]=limxaf(x)f(a)xa(xa)=f(a)0=0\lim_{x \to a} [f(x) - f(a)] = \lim_{x \to a} \frac{f(x) - f(a)}{x - a} \cdot (x - a) = f'(a) \cdot 0 = 0

Therefore, limxaf(x)=f(a)\displaystyle\lim_{x \to a} f(x) = f(a)So ff is continuous at aa. \blacksquare

The converse is false: f(x)=xf(x) = |x| is continuous at x=0x = 0 but not differentiable there Because the left-hand and right-hand derivatives disagree.

A function fails to be differentiable at a point if:

  1. There is a corner (left and right derivatives differ), e.g., x|x| at x=0x = 0.
  2. There is a cusp, e.g., f(x)=x2/3f(x) = x^{2/3} at x=0x = 0.
  3. There is a vertical tangent, e.g., f(x)=x3f(x) = \sqrt[3]{x} at x=0x = 0.
  4. There is a discontinuity.

Proof that x|x| is not differentiable at x=0x = 0.

Left-hand derivative: limh0hh=limh0hh=1\displaystyle\lim_{h \to 0^-} \frac{|h|}{h} = \lim_{h \to 0^-} \frac{-h}{h} = -1.

Right-hand derivative: limh0+hh=limh0+hh=1\displaystyle\lim_{h \to 0^+} \frac{|h|}{h} = \lim_{h \to 0^+} \frac{h}{h} = 1.

Since 11-1 \neq 1The derivative does not exist. \blacksquare

Proof that f(x)=x2/3f(x) = x^{2/3} has a cusp at x=0x = 0.

F(x)=23x1/3=23x3F'(x) = \frac{2}{3}x^{-1/3} = \frac{2}{3\sqrt[3]{x}}

As x \to 0^+$$f'(x) \to +\infty. As x \to 0^-$$f'(x) \to -\infty.

The left and right derivatives are both infinite but with opposite signs, creating a cusp. The Tangent line approaches vertical from both sides. \blacksquare

Let cc be a constant and nn a real number:

  1. Constant rule: ddx[c]=0\displaystyle\frac{d}{dx}[c] = 0
  2. Power rule: ddx[xn]=nxn1\displaystyle\frac{d}{dx}[x^n] = nx^{n-1}
  3. Constant multiple rule: ddx[cf(x)]=cf(x)\displaystyle\frac{d}{dx}[cf(x)] = cf'(x)
  4. Sum/Difference rule: ddx[f(x)±g(x)]=f(x)±g(x)\displaystyle\frac{d}{dx}[f(x) \pm g(x)] = f'(x) \pm g'(x)
ddx[f(x)g(x)]=f(x)g(x)+f(x)g(x)\frac{d}{dx}[f(x) \cdot g(x)] = f'(x)g(x) + f(x)g'(x)

Proof sketch. Write F(x)=f(x)g(x)F(x) = f(x)g(x) and expand the difference quotient F(x+h)F(x)h\frac{F(x+h) - F(x)}{h} by adding and subtracting f(x+h)g(x)f(x+h)g(x):

f(x+h)g(x+h)f(x)g(x)h=f(x+h)g(x+h)g(x)h+g(x)f(x+h)f(x)h\frac{f(x+h)g(x+h) - f(x)g(x)}{h} = f(x+h)\frac{g(x+h) - g(x)}{h} + g(x)\frac{f(x+h) - f(x)}{h}

Taking limits as h0h \to 0 gives the result. \blacksquare

ddx ⁣[f(x)g(x)]=g(x)f(x)f(x)g(x)[g(x)]2\frac{d}{dx}\!\left[\frac{f(x)}{g(x)}\right] = \frac{g(x)f'(x) - f(x)g'(x)}{[g(x)]^2}

Proof. Let F(x)=f(x)g(x)F(x) = \frac{f(x)}{g(x)}So f(x)=F(x)g(x)f(x) = F(x)g(x). Differentiating using the product Rule:

F(x)=F(x)g(x)+F(x)g(x)F'(x) = F'(x)g(x) + F(x)g'(x)F(x)g(x)=f(x)F(x)g(x)=f(x)f(x)g(x)g(x)F'(x)g(x) = f'(x) - F(x)g'(x) = f'(x) - \frac{f(x)}{g(x)}g'(x)F(x)=f(x)g(x)f(x)g(x)[g(x)]2=f(x)g(x)f(x)g(x)[g(x)]2F'(x) = \frac{f'(x)}{g(x)} - \frac{f(x)g'(x)}{[g(x)]^2} = \frac{f'(x)g(x) - f(x)g'(x)}{[g(x)]^2}

\blacksquare

Mnemonic: “Low d-High minus High d-Low, draw a line and square below.”

ddx[f(g(x))]=f(g(x))g(x)\frac{d}{dx}[f(g(x))] = f'(g(x)) \cdot g'(x)

Why the chain rule works. If y=f(u)y = f(u) and u=g(x)u = g(x)Then dydx=dydududx\frac{dy}{dx} = \frac{dy}{du} \cdot \frac{du}{dx}. This is a cancellation of the dudu terms (formalised by limits).

Proof of the chain rule. Let u=g(x)u = g(x) and define:

K(h) = \frac{f(u + h) - f(u)}{h} - f'(u) \quad \mathrm{when h \ne 0, \quad k(0) = 0

Then limh0k(h)=0\displaystyle\lim_{h \to 0} k(h) = 0 and f(u+h)f(u)=[f(u)+k(h)]hf(u+h) - f(u) = [f'(u) + k(h)] \cdot h for all hh.

Let Δu=g(x+h)g(x)\Delta u = g(x+h) - g(x). Then:

f(g(x+h))f(g(x))h=f(u+Δu)f(u)h=[f(u)+k(Δu)]Δuh\frac{f(g(x+h)) - f(g(x))}{h} = \frac{f(u + \Delta u) - f(u)}{h} = [f'(u) + k(\Delta u)] \cdot \frac{\Delta u}{h}

Taking h0h \to 0: Δu0\Delta u \to 0 (since gg is differentiable, hence continuous), so k(Δu)0k(\Delta u) \to 0Giving:

F(g(x))g(x)F'(g(x)) \cdot g'(x)

\blacksquare

Example

Find ddx[(3x2+1)5]\displaystyle\frac{d}{dx}\left[(3x^2 + 1)^5\right].

Let u=3x2+1u = 3x^2 + 1So y=u5y = u^5.

dydx=5u4dudx=5(3x2+1)46x=30x(3x2+1)4\frac{dy}{dx} = 5u^4 \cdot \frac{du}{dx} = 5(3x^2 + 1)^4 \cdot 6x = 30x(3x^2 + 1)^4

Example

Find ddx[sin3(2x)]\displaystyle\frac{d}{dx}\left[\sin^3(2x)\right].

Apply the chain rule twice:

ddx[sin3(2x)]=3sin2(2x)cos(2x)2=6sin2(2x)cos(2x)\frac{d}{dx}\left[\sin^3(2x)\right] = 3\sin^2(2x) \cdot \cos(2x) \cdot 2 = 6\sin^2(2x)\cos(2x)

Example

Find ddx[ln(sinx)]\displaystyle\frac{d}{dx}\left[\ln(\sin x)\right].

Let u=sinxu = \sin xSo y=lnuy = \ln u.

dydx=1sinxcosx=cotx\frac{dy}{dx} = \frac{1}{\sin x} \cdot \cos x = \cot x

Example

Find ddx[e3x+1]\displaystyle\frac{d}{dx}\left[e^{\sqrt{3x+1}}\right].

Apply the chain rule twice:

ddx[e3x+1]=e3x+1ddx ⁣[(3x+1)1/2]=e3x+112(3x+1)1/23=3e3x+123x+1\frac{d}{dx}\left[e^{\sqrt{3x+1}}\right] = e^{\sqrt{3x+1}} \cdot \frac{d}{dx}\!\left[(3x+1)^{1/2}\right] = e^{\sqrt{3x+1}} \cdot \frac{1}{2}(3x+1)^{-1/2} \cdot 3 = \frac{3e^{\sqrt{3x+1}}}{2\sqrt{3x+1}}ddx[sinx]=cosxddx[cosx]=sinx\frac{d}{dx}[\sin x] = \cos x \qquad \frac{d}{dx}[\cos x] = -\sin xddx[tanx]=sec2xddx[cotx]=csc2x\frac{d}{dx}[\tan x] = \sec^2 x \qquad \frac{d}{dx}[\cot x] = -\csc^2 xddx[secx]=secxtanxddx[cscx]=cscxcotx\frac{d}{dx}[\sec x] = \sec x \tan x \qquad \frac{d}{dx}[\csc x] = -\csc x \cot x

Proof that ddx[sinx]=cosx\displaystyle\frac{d}{dx}[\sin x] = \cos x

Section titled “Proof that ddx[sin⁡x]=cos⁡x\displaystyle\frac{d}{dx}[\sin x] = \cos xdxd​[sinx]=cosx”
ddx[sinx]=limh0sin(x+h)sinxh=limh0sinxcosh+cosxsinhsinxh\frac{d}{dx}[\sin x] = \lim_{h \to 0} \frac{\sin(x+h) - \sin x}{h} = \lim_{h \to 0} \frac{\sin x \cos h + \cos x \sin h - \sin x}{h}=limh0 ⁣[sinxcosh1h+cosxsinhh]=sinx0+cosx1=cosx= \lim_{h \to 0}\!\left[\sin x \cdot \frac{\cos h - 1}{h} + \cos x \cdot \frac{\sin h}{h}\right] = \sin x \cdot 0 + \cos x \cdot 1 = \cos x

Proof that ddx[tanx]=sec2x\displaystyle\frac{d}{dx}[\tan x] = \sec^2 x

Section titled “Proof that ddx[tan⁡x]=sec⁡2x\displaystyle\frac{d}{dx}[\tan x] = \sec^2 xdxd​[tanx]=sec2x”
ddx[tanx]=ddx ⁣[sinxcosx]=cosxcosxsinx(sinx)cos2x=cos2x+sin2xcos2x=1cos2x=sec2x\frac{d}{dx}[\tan x] = \frac{d}{dx}\!\left[\frac{\sin x}{\cos x}\right] = \frac{\cos x \cdot \cos x - \sin x \cdot (-\sin x)}{\cos^2 x} = \frac{\cos^2 x + \sin^2 x}{\cos^2 x} = \frac{1}{\cos^2 x} = \sec^2 x

\blacksquare

Derivatives of Exponential and Logarithmic Functions

Section titled “Derivatives of Exponential and Logarithmic Functions”
ddx[ex]=exddx[ax]=axlna\frac{d}{dx}[e^x] = e^x \qquad \frac{d}{dx}[a^x] = a^x \ln addx[lnx]=1xddx[logax]=1xlna\frac{d}{dx}[\ln x] = \frac{1}{x} \qquad \frac{d}{dx}[\log_a x] = \frac{1}{x \ln a}

Proof that ddx[ex]=ex\displaystyle\frac{d}{dx}[e^x] = e^x

Section titled “Proof that ddx[ex]=ex\displaystyle\frac{d}{dx}[e^x] = e^xdxd​[ex]=ex”
ddx[ex]=limh0ex+hexh=exlimh0eh1h=ex1=ex\frac{d}{dx}[e^x] = \lim_{h \to 0} \frac{e^{x+h} - e^x}{h} = e^x \lim_{h \to 0} \frac{e^h - 1}{h} = e^x \cdot 1 = e^x

Where we used limh0eh1h=1\displaystyle\lim_{h \to 0} \frac{e^h - 1}{h} = 1.

Proof that ddx[lnx]=1x\displaystyle\frac{d}{dx}[\ln x] = \frac{1}{x}

Section titled “Proof that ddx[ln⁡x]=1x\displaystyle\frac{d}{dx}[\ln x] = \frac{1}{x}dxd​[lnx]=x1​”

Let y=lnxy = \ln xSo ey=xe^y = x. Differentiating implicitly: eydydx=1e^y \frac{dy}{dx} = 1So dydx=1ey=1x\frac{dy}{dx} = \frac{1}{e^y} = \frac{1}{x}. \blacksquare

Proof that ddx[ax]=axlna\displaystyle\frac{d}{dx}[a^x] = a^x \ln a

Section titled “Proof that ddx[ax]=axln⁡a\displaystyle\frac{d}{dx}[a^x] = a^x \ln adxd​[ax]=axlna”

Write ax=exlnaa^x = e^{x \ln a}. Then:

ddx[ax]=ddx[exlna]=exlnalna=axlna\frac{d}{dx}[a^x] = \frac{d}{dx}[e^{x \ln a}] = e^{x \ln a} \cdot \ln a = a^x \ln a

\blacksquare

ddx[arcsinx]=11x2ddx[arccosx]=11x2\frac{d}{dx}[\arcsin x] = \frac{1}{\sqrt{1 - x^2}} \qquad \frac{d}{dx}[\arccos x] = \frac{-1}{\sqrt{1 - x^2}}ddx[arctanx]=11+x2\frac{d}{dx}[\arctan x] = \frac{1}{1 + x^2}

Derivation of arcsinx\arcsin x. Let y=arcsinxy = \arcsin xSo x=sinyx = \sin y. Differentiating: 1=cosydydx1 = \cos y \cdot \frac{dy}{dx}, so dydx=1cosy=11sin2y=11x2\frac{dy}{dx} = \frac{1}{\cos y} = \frac{1}{\sqrt{1 - \sin^2 y}} = \frac{1}{\sqrt{1 - x^2}}.

Derivation of arctanx\arctan x. Let y=arctanxy = \arctan xSo x=tanyx = \tan y. Differentiating: 1=sec2ydydx1 = \sec^2 y \cdot \frac{dy}{dx}So dydx=1sec2y=cos2y\frac{dy}{dx} = \frac{1}{\sec^2 y} = \cos^2 y.

Since sec2y=1+tan2y=1+x2\sec^2 y = 1 + \tan^2 y = 1 + x^2We get cos2y=11+x2\cos^2 y = \frac{1}{1 + x^2}So dydx=11+x2\frac{dy}{dx} = \frac{1}{1 + x^2}. \blacksquare

When yy is defined implicitly as a function of xxDifferentiate both sides with respect to xx And solve for dydx\frac{dy}{dx}.

Example

Find dydx\displaystyle\frac{dy}{dx} for x2+y2=25x^2 + y^2 = 25.

Differentiate both sides with respect to xx:

2x+2ydydx=0    dydx=xy2x + 2y\frac{dy}{dx} = 0 \implies \frac{dy}{dx} = -\frac{x}{y}

Example

Find the equation of the tangent line to x2+y2=25x^2 + y^2 = 25 at the point (3,4)(3, 4).

From the previous example, dydx=xy\displaystyle\frac{dy}{dx} = -\frac{x}{y}. At (3,4)(3, 4):

dydx(3,4)=34\left.\frac{dy}{dx}\right|_{(3,4)} = -\frac{3}{4}

The tangent line is y4=34(x3)y - 4 = -\frac{3}{4}(x - 3)Or 3x+4y=253x + 4y = 25.

Example

Find dydx\displaystyle\frac{dy}{dx} for x3+y3=6xyx^3 + y^3 = 6xy.

Differentiate implicitly:

3x2+3y2dydx=6y+6xdydx3x^2 + 3y^2\frac{dy}{dx} = 6y + 6x\frac{dy}{dx}3y2dydx6xdydx=6y3x23y^2\frac{dy}{dx} - 6x\frac{dy}{dx} = 6y - 3x^2dydx(3y26x)=6y3x2\frac{dy}{dx}(3y^2 - 6x) = 6y - 3x^2dydx=6y3x23y26x=2yx2y22x\frac{dy}{dx} = \frac{6y - 3x^2}{3y^2 - 6x} = \frac{2y - x^2}{y^2 - 2x}

Example

Find d2ydx2\displaystyle\frac{d^2y}{dx^2} for x2+y2=25x^2 + y^2 = 25.

We have dydx=xy\frac{dy}{dx} = -\frac{x}{y}.

Differentiating again:

d2ydx2=ddx ⁣(xy)=yxdydxy2=yx(x/y)y2=y2+x2y3=25y3\frac{d^2y}{dx^2} = \frac{d}{dx}\!\left(-\frac{x}{y}\right) = -\frac{y - x\frac{dy}{dx}}{y^2} = -\frac{y - x(-x/y)}{y^2} = -\frac{y^2 + x^2}{y^3} = -\frac{25}{y^3}

Example

Find dydx\displaystyle\frac{dy}{dx} for exy+y=x2e^{xy} + y = x^2.

Differentiate implicitly with respect to xx:

Exy ⁣(y+xdydx)+dydx=2xE^{xy}\!\left(y + x\frac{dy}{dx}\right) + \frac{dy}{dx} = 2xExyy+exyxdydx+dydx=2xE^{xy} \cdot y + e^{xy} \cdot x \frac{dy}{dx} + \frac{dy}{dx} = 2xdydx(xexy+1)=2xyexy\frac{dy}{dx}(xe^{xy} + 1) = 2x - ye^{xy}dydx=2xyexyxexy+1\frac{dy}{dx} = \frac{2x - ye^{xy}}{xe^{xy} + 1}

The second derivative is the derivative of the first derivative:

F(x)=ddx[f(x)]=d2ydx2F''(x) = \frac{d}{dx}[f'(x)] = \frac{d^2y}{dx^2}

Similarly, f'''(x)$$f^{(4)}(x)Etc. Denote higher-order derivatives.

  • If f''(x) \gt 0$$f is concave up at xx.
  • If f''(x) \lt 0$$f is concave down at xx.
  • If f(x)f''(x) changes sign at x=cx = cThen (c,f(c))(c, f(c)) is an inflection point.

Theorem. If ff has a local maximum at cc and f(c)f''(c) exists, then f(c)0f''(c) \leq 0. If ff has A local minimum at cc and f(c)f''(c) exists, then f(c)0f''(c) \geq 0.

This is the second derivative test for concavity at critical points.

Common notations for derivatives include:

  • f'(x)$$f''(x)$$f'''(x) (prime notation)
  • \frac{df}{dx}$$\frac{d^2f}{dx^2} (Leibniz notation)
  • \dot{x}$$\ddot{x} (Newton’s dot notation for time derivatives)

When two or more quantities are related by an equation, their rates of change are also related.

Example

A ladder 10 ft long rests against a vertical wall. If the bottom slides away at 1 ft/s, how fast is The top sliding down when the bottom is 6 ft from the wall?

Let xx = distance from wall to bottom, yy = height of top on wall. Then x2+y2=100x^2 + y^2 = 100.

Differentiate with respect to tt:

2xdxdt+2ydydt=02x\frac{dx}{dt} + 2y\frac{dy}{dt} = 0

When x=6x = 6: y=10036=8y = \sqrt{100 - 36} = 8. Given dxdt=1\frac{dx}{dt} = 1:

2(6)(1) + 2(8)\frac{dy}{dt} = 0 \implies \frac{dy}{dt} = -\frac{12}{16} = -\frac{3}{4} \mathrm{ ft/s

The negative sign confirms the top is sliding down.

Example

A spherical balloon is inflated at a rate of 10 \mathrm{ cm^3/\mathrm{s. How fast is the radius Increasing when the radius is 5 cm? (V=43πr3V = \frac{4}{3}\pi r^3)

dVdt=4πr2drdt\frac{dV}{dt} = 4\pi r^2 \frac{dr}{dt}10 = 4\pi(25)\frac{dr}{dt} \implies \frac{dr}{dt} = \frac{10}{100\pi} = \frac{1}{10\pi} \mathrm{ cm/s

Example

A 15 ft ladder leans against a wall. The bottom slides away at 2 ft/s. How fast is the angle between The ladder and the ground changing when the bottom is 9 ft from the wall?

Let θ\theta be the angle between the ladder and the ground. Then cosθ=x15\cos\theta = \frac{x}{15}So x=15cosθx = 15\cos\theta.

Differentiating with respect to tt:

dxdt=15sinθdθdt\frac{dx}{dt} = -15\sin\theta \frac{d\theta}{dt}

When x=9x = 9: cosθ=915=35\cos\theta = \frac{9}{15} = \frac{3}{5}So sinθ=45\sin\theta = \frac{4}{5}.

2=1545dθdt=12dθdt2 = -15 \cdot \frac{4}{5} \cdot \frac{d\theta}{dt} = -12 \frac{d\theta}{dt}\frac{d\theta}{dt} = -\frac{2}{12} = -\frac{1}{6} \mathrm{ rad/s

The angle is decreasing at 16\frac{1}{6} rad/s.

The tangent line at x=ax = a gives a linear approximation:

F(x)f(a)+f(a)(xa)F(x) \approx f(a) + f'(a)(x - a)

This is useful for estimating values of functions near known points.

Example

Use linear approximation to estimate 4.1\sqrt{4.1}.

Let f(x) = \sqrt{x}$$a = 4.

F(x)=12x    f(4)=2,f(4)=14F'(x) = \frac{1}{2\sqrt{x}} \implies f(4) = 2, \quad f'(4) = \frac{1}{4}4.12+14(4.14)=2+0.025=2.025\sqrt{4.1} \approx 2 + \frac{1}{4}(4.1 - 4) = 2 + 0.025 = 2.025

(The actual value is approximately 2.02485.)

Example

Use linear approximation to estimate (1.02)10(1.02)^{10}.

Let f(x) = x^{10}$$a = 1.

F(x)=10x9    f(1)=1,f(1)=10F'(x) = 10x^9 \implies f(1) = 1, \quad f'(1) = 10(1.02)101+10(0.02)=1.20(1.02)^{10} \approx 1 + 10(0.02) = 1.20

(The actual value is approximately 1.21899, showing that linear approximation is less accurate when xx is farther from aa.)

If ff is continuous on [a,b][a, b] and differentiable on (a,b)(a, b)Then there exists at least one c(a,b)c \in (a, b) such that:

F(c)=f(b)f(a)baF'(c) = \frac{f(b) - f(a)}{b - a}

This means the instantaneous rate of change equals the average rate of change at some interior Point.

Geometric interpretation. The MVT guarantees the existence of a tangent line parallel to the Secant line joining (a,f(a))(a, f(a)) and (b,f(b))(b, f(b)).

Proof of the MVT. Let g(x)=f(x)f(b)f(a)ba(xa)f(a)g(x) = f(x) - \frac{f(b) - f(a)}{b-a}(x - a) - f(a). Then g(a)=g(b)=0g(a) = g(b) = 0. By Rolle’s Theorem, there exists c(a,b)c \in (a, b) with g(c)=0g'(c) = 0Which gives f(c)=f(b)f(a)baf'(c) = \frac{f(b) - f(a)}{b-a}. \blacksquare

If ff is continuous on [a,b][a, b]Differentiable on (a,b)(a, b)And f(a)=f(b)f(a) = f(b)Then there exists At least one c(a,b)c \in (a, b) such that f(c)=0f'(c) = 0.

Rolle’s Theorem is a special case of the MVT where f(a)=f(b)f(a) = f(b).

Application of Rolle’s Theorem. Rolle’s Theorem is used to prove that a differentiable function Has at most one root in an interval. If it had two roots, Rolle’s Theorem would give a point where The derivative is zero, leading to a contradiction.

Example

Show that f(x)=x33x+1f(x) = x^3 - 3x + 1 has exactly one real root.

Note that f(0)=1f(0) = 1 and f(2)=8+6+1=1f(-2) = -8 + 6 + 1 = -1. By the IVT, there is at least one root in (2,0)(-2, 0).

Suppose there are two distinct roots a<ba \lt b. Then f(a)=f(b)=0f(a) = f(b) = 0And by Rolle’s Theorem, There exists c(a,b)c \in (a, b) with f(c)=0f'(c) = 0. But f(x)=3x23=3(x+1)(x1)f'(x) = 3x^2 - 3 = 3(x+1)(x-1)Which is zero Only at x=±1x = \pm 1. This does not lead to a contradiction on its own, so we must examine further.

In fact, f(-2) = -1$$f(0) = 1$$f(1) = -1$$f(2) = 3. So ff has at least one root in (2,0)(-2, 0)At least one in (0,1)(0, 1)And possibly one in (1,2)(1, 2). Rolle’s Theorem applied to Consecutive roots shows that each pair of roots must bracket either x=1x = -1 or x=1x = 1.

Testing: f(1)=1+3+1=3>0f(-1) = -1 + 3 + 1 = 3 \gt 0. So the root in (2,0)(-2, 0) is in (2,1)(-2, -1)And the root in (0,1)(0, 1) is in (0,1)(0, 1). These bracket different critical points. In fact, ff has three real roots, And Rolle’s Theorem confirms this is consistent since the critical points at x=±1x = \pm 1 bracket the Three roots.

A critical number of ff is a value cc in the domain of ff where f(c)=0f'(c) = 0 or f(c)f'(c) does Not exist.

Let cc be a critical number:

  • If ff' changes from positive to negative at ccThen f(c)f(c) is a local maximum.
  • If ff' changes from negative to positive at ccThen f(c)f(c) is a local minimum.
  • If ff' does not change sign at ccThen f(c)f(c) is neither.

Let f(c)f''(c) exist with f(c)=0f'(c) = 0:

  • If f(c)>0f''(c) \gt 0Then f(c)f(c) is a local minimum.
  • If f(c)<0f''(c) \lt 0Then f(c)f(c) is a local maximum.
  • If f(c)=0f''(c) = 0The test is inconclusive.

When to use which test. The first derivative test always works. The second derivative test is Faster but sometimes inconclusive. When f(c)=0f''(c) = 0You must fall back to the first derivative Test.

Example where the second derivative test is inconclusive. Consider f(x)=x4f(x) = x^4. f(x)=4x3=0f'(x) = 4x^3 = 0 gives x=0x = 0And f(x)=12x2f''(x) = 12x^2So f(0)=0f''(0) = 0 — the test is inconclusive. But f(x)=4x3f'(x) = 4x^3 changes from negative to positive at x=0x = 0So ff has a local minimum at x=0x = 0 by the first derivative test.

To solve optimization problems:

  1. Identify the quantity to optimize and the constraint.
  2. Write an equation relating the variables.
  3. Express the quantity as a function of a single variable.
  4. Find critical points and apply the first or second derivative test.
  5. Verify the result answers the original question.

Example

A farmer has 200 ft of fencing. Find the dimensions of the rectangular pen that maximizes the area.

Let xx and yy be the dimensions. Then 2x+2y=2002x + 2y = 200So y=100xy = 100 - x.

A=xy=x(100x)=100xx2A = xy = x(100 - x) = 100x - x^2dAdx=1002x=0    x=50\frac{dA}{dx} = 100 - 2x = 0 \implies x = 50\frac{d^2A}{dx^2} = -2 \lt 0 \quad \mathrm{(confirms maximum)

So x = 50$$y = 50And the maximum area is 2500 \mathrm{ ft^2.

Example

Find the minimum value of f(x)=x+4xf(x) = x + \frac{4}{x} for x>0x \gt 0.

F'(x) = 1 - \frac{4}{x^2} = 0 \implies x^2 = 4 \implies x = 2 \mathrm{ (since x \gt 0)F(2)=2+2=4F(2) = 2 + 2 = 4F''(2) = \frac{8}{8} = 1 \gt 0 \quad \mathrm{(confirms minimum)

The minimum value is 44 at x=2x = 2.

Example

A rectangular box with a square base has volume 500 \mathrm{ cm^3. The material for the base costs Twice as much as the material for the sides. Minimise the cost of the material.

Let the base have side length xx cm and height hh cm. Let the cost per unit area of the sides be cc. Then the base costs 2c2c per unit area.

Volume: x2h=500x^2 h = 500So h=500x2h = \frac{500}{x^2}.

Cost: C=2cx2+4cxh=2cx2+4cx500x2=2cx2+2000cxC = 2c \cdot x^2 + 4c \cdot xh = 2cx^2 + 4cx \cdot \frac{500}{x^2} = 2cx^2 + \frac{2000c}{x}.

dCdx=4cx2000cx2=0\frac{dC}{dx} = 4cx - \frac{2000c}{x^2} = 04x^3 = 2000 \implies x^3 = 500 \implies x = \sqrt[3]{500} \approx 7.937 \mathrm{ cmH = \frac{500}{500^{2/3}} = 500^{1/3} = \sqrt[3]{500} \approx 7.937 \mathrm{ cm

The cost is minimised when the box is a cube. d2Cdx2=4c+4000cx3>0\frac{d^2C}{dx^2} = 4c + \frac{4000c}{x^3} \gt 0 Confirming a minimum.

When the domain is a closed interval [a,b][a, b]The absolute maximum and minimum occur at critical Points or at endpoints.

Procedure:

  1. Find all critical points in (a,b)(a, b).
  2. Evaluate ff at all critical points and at both endpoints.
  3. The largest value is the absolute max; the smallest is the absolute min.

Example

Find the absolute maximum and minimum of f(x)=x33x2+4f(x) = x^3 - 3x^2 + 4 on [1,4][-1, 4].

F'(x) = 3x^2 - 6x = 3x(x - 2) = 0 \implies x = 0 \mathrm{ or x = 2

f(-1) = -1 - 3 + 4 = 0$$f(0) = 4$$f(2) = 8 - 12 + 4 = 0$$f(4) = 64 - 48 + 4 = 20.

Absolute minimum: 00 at x=1x = -1 and x=2x = 2. Absolute maximum: 2020 at x=4x = 4.

  1. Forgetting the chain rule. When differentiating a composition, always account for the inner function’s derivative. For example, ddx[sin(x2)]cos(x2)\frac{d}{dx}[\sin(x^2)] \ne \cos(x^2).
  2. Incorrect sign in the quotient rule. Remember: “Low d-High minus High d-Low, draw a line and square below.”
  3. Confusing ddx[ex]\frac{d}{dx}[e^x] with ddx[xe]\frac{d}{dx}[x^e]. The former is exe^x; the latter is exe1ex^{e-1}.
  4. Implicit differentiation: forgetting to apply the chain rule to yy terms. When differentiating y2y^2 with respect to xxThe result is 2ydydx2y\frac{dy}{dx}Not 2y2y.
  5. Units in related rates. Always include units and check that they make dimensional sense.
  6. Not checking endpoints in optimization problems on closed intervals.
  7. Using the second derivative test when it is inconclusive (f(c)=0f''(c) = 0). Fall back to the first derivative test.
  8. Confusing the second derivative with the first. The second derivative tells you about concavity, not the slope.
  9. Dropping negative signs in implicit differentiation. Be systematic: write every yy term with dydx\frac{dy}{dx} attached.
  10. Linear approximation overreach. The approximation f(x)f(a)+f(a)(xa)f(x) \approx f(a) + f'(a)(x-a) is accurate only near x=ax = a. Using it far from aa can give wildly inaccurate results.
  1. Find dydx\displaystyle\frac{dy}{dx} for exy+y=x2e^{xy} + y = x^2 using implicit differentiation.

  2. A spherical balloon is inflated at a rate of 10 \mathrm{ cm^3/\mathrm{s. How fast is the radius increasing when the radius is 5 cm? (V=43πr3V = \frac{4}{3}\pi r^3)

  3. Find all critical points of f(x)=x44x3+6x24x+1f(x) = x^4 - 4x^3 + 6x^2 - 4x + 1 and classify them using the second derivative test.

  4. Use the Mean Value Theorem to show that sinbsinaba|\sin b - \sin a| \le |b - a| for all a,ba, b.

  5. Find the equation of the tangent line to y=ln(x2+1)y = \ln(x^2 + 1) at x=1x = 1.

  6. A 15 ft ladder leans against a wall. The bottom slides away at 2 ft/s. How fast is the angle between the ladder and the ground changing when the bottom is 9 ft from the wall?

  7. Find the absolute maximum and minimum of f(x)=x33x2+4f(x) = x^3 - 3x^2 + 4 on [1,4][-1, 4].

  8. Use linear approximation to estimate (1.02)10(1.02)^{10}.

  9. Find ddx[x2+1e2x]\displaystyle\frac{d}{dx}\left[\frac{x^2 + 1}{e^{2x}}\right] and find all stationary points.

  10. Find d2ydx2\displaystyle\frac{d^2y}{dx^2} for x3+y3=6xyx^3 + y^3 = 6xy at the point (3,3)(3, 3).

  11. A rectangular box with a square base has volume 500 \mathrm{ cm^3. The material for the base costs twice as much as the material for the sides. Minimise the cost of the material.

  12. Prove that the derivative of f(x)=x3f(x) = x^3 is f(x)=3x2f'(x) = 3x^2 from first principles.

  13. Find dydx\displaystyle\frac{dy}{dx} for sin(x+y)=xcosy\sin(x + y) = x \cos y.

  14. Find the inflection points of f(x)=x46x2+4f(x) = x^4 - 6x^2 + 4.

  15. A conical tank (vertex pointing down) has radius 5 ft at the top and height 10 ft. Water is pumped in at 3 \mathrm{ft^3/\mathrm{min. How fast is the water level rising when the water is 6 ft deep?

  16. Find the dimensions of the rectangle of maximum area that can be inscribed in a semicircle of radius rr.

Question 1: Implicit differentiation

Find dydx\frac{dy}{dx} for the curve x3+y3=6xyx^3 + y^3 = 6xy. Then find the equation of the tangent line at the point (3,3)(3, 3).

Answer

Differentiate implicitly: 3x2+3y2dydx=6y+6xdydx3x^2 + 3y^2 \frac{dy}{dx} = 6y + 6x \frac{dy}{dx}.

3y2dydx6xdydx=6y3x23y^2 \frac{dy}{dx} - 6x \frac{dy}{dx} = 6y - 3x^2.

dydx=6y3x23y26x=2yx2y22x\frac{dy}{dx} = \frac{6y - 3x^2}{3y^2 - 6x} = \frac{2y - x^2}{y^2 - 2x}.

At (3,3)(3, 3): dydx=6996=33=1\frac{dy}{dx} = \frac{6 - 9}{9 - 6} = \frac{-3}{3} = -1.

Tangent line: y3=1(x3)y - 3 = -1(x - 3)So y=x+6y = -x + 6.

Question 2: Related rates

A spherical balloon is being inflated at a rate of 100 \mathrm{ cm^3/s. How fast is the radius increasing when the radius is 10 \mathrm{ cm?

Answer

V=43πr3V = \frac{4}{3}\pi r^3. Differentiate with respect to time: dVdt=4πr2drdt\frac{dV}{dt} = 4\pi r^2 \frac{dr}{dt}.

100=4π(10)2drdt=400πdrdt100 = 4\pi(10)^2 \frac{dr}{dt} = 400\pi \frac{dr}{dt}.

\frac{dr}{dt} = \frac{100}{400\pi} = \frac{1}{4\pi} \approx 0.080 \mathrm{ cm/s.

Question 3: L’Hopital’s rule

Evaluate limx0ex1xx2\displaystyle\lim_{x \to 0} \frac{e^x - 1 - x}{x^2}.

Answer

This is 0/00/0. Apply L’Hopital’s rule:

limx0ex12x\displaystyle\lim_{x \to 0} \frac{e^x - 1}{2x}.

Still 0/00/0. Apply again:

limx0ex2=12\displaystyle\lim_{x \to 0} \frac{e^x}{2} = \frac{1}{2}.

Alternatively, this is the coefficient of x2/2!x^2/2! in the Taylor series of exe^xConfirming the answer.

Question 4: Optimisation with constraint

A rectangular box with a square base and no top is to have a volume of 108 \mathrm{ cm^3. Find the dimensions that minimise the surface area.

Answer

Let base side = xxHeight = hh. Volume: x2h=108x^2 h = 108So h=108/x2h = 108/x^2.

Surface area: S=x2+4xh=x2+4x(108/x2)=x2+432/xS = x^2 + 4xh = x^2 + 4x(108/x^2) = x^2 + 432/x.

dSdx=2x432/x2=0\frac{dS}{dx} = 2x - 432/x^2 = 0So 2x = 432/x^2$$x^3 = 216$$x = 6 \mathrm{ cm.

h = 108/36 = 3 \mathrm{ cm.

d2Sdx2=2+864/x3>0\frac{d^2S}{dx^2} = 2 + 864/x^3 \gt 0 at x=6x = 6Confirming minimum.

Dimensions: 6 \times 6 \times 3 \mathrm{ cmMinimum surface area = 36 + 432/6 = 108 \mathrm{ cm^2.

Question 5: Mean Value Theorem

Verify that the function f(x)=x33x+1f(x) = x^3 - 3x + 1 satisfies the conditions of the Mean Value Theorem on [2,2][-2, 2]And find all values of cc that satisfy the conclusion.

Answer

ff is a polynomial, so it is continuous on [2,2][-2, 2] and differentiable on (2,2)(-2, 2).

f(2)=86+1=3f(2) = 8 - 6 + 1 = 3. f(2)=8+6+1=1f(-2) = -8 + 6 + 1 = -1.

f(c)=f(2)f(2)2(2)=3(1)4=1f'(c) = \frac{f(2) - f(-2)}{2 - (-2)} = \frac{3 - (-1)}{4} = 1.

f(x)=3x23=1f'(x) = 3x^2 - 3 = 1So 3x^2 = 4$$x^2 = 4/3$$x = \pm 2/\sqrt{3} \approx \pm 1.155.

Both values are in (2,2)(-2, 2). The MVT is satisfied at c=2/3c = 2/\sqrt{3} and c=2/3c = -2/\sqrt{3}.


:::tip Diagnostic Test Ready to test your understanding of Derivatives? The contains the hardest questions within the AP specification for this topic, each with a full worked solution.

Unit tests probe edge cases and common misconceptions. Integration tests combine Derivatives with other AP Calculus topics to test synthesis under exam conditions.

See for instructions on self-marking and building a personal test matrix.

This topic covers the mathematical techniques and concepts related to derivatives, including key theorems, methods, and problem-solving approaches.

Key concepts include:

  • sine, cosine, and tangent functions
  • trigonometric identities
  • solving trigonometric equations
  • the sine and cosine rules
  • radian measure and arc length

Regular practice with a variety of question types is essential to build fluency and confidence in applying these mathematical techniques.

Worked examples demonstrating the application of key concepts are covered in the detailed sub-pages linked above.

:::