Skip to content

Derivatives -- Diagnostic Tests

Tests edge cases, boundary conditions, and common misconceptions for derivatives.

UT-1: Chain Rule with Three Compositions and Implicit Terms

Section titled “UT-1: Chain Rule with Three Compositions and Implicit Terms”

Question:

Let y=sin2 ⁣(e3x2+1)y = \sin^2\!\left(e^{3x^2 + 1}\right). Find d2ydx2\dfrac{d^2y}{dx^2} and evaluate it at x=0x = 0.

Solution:

Let u=e3x2+1u = e^{3x^2 + 1}Then y=sin2(u)=(sinu)2y = \sin^2(u) = (\sin u)^2.

dydx=2sin(u)cos(u)dudx=sin(2u)e3x2+16x\frac{dy}{dx} = 2\sin(u) \cdot \cos(u) \cdot \frac{du}{dx} = \sin(2u) \cdot e^{3x^2+1} \cdot 6x

dydx=6xe3x2+1sin ⁣(2e3x2+1)\frac{dy}{dx} = 6x \, e^{3x^2+1} \sin\!\left(2e^{3x^2+1}\right)

For d2ydx2\dfrac{d^2y}{dx^2}Apply the product rule to 6xe3x2+1sin(2e3x2+1)6x \cdot e^{3x^2+1} \cdot \sin(2e^{3x^2+1}). Let A = 6x$$B = e^{3x^2+1}$$C = \sin(2e^{3x^2+1}). Then:

d2ydx2=A"BC+ABC+ABC\frac{d^2y}{dx^2} = A"BC + AB'C + ABC'

A=6A' = 6

B=e3x2+16xB' = e^{3x^2+1} \cdot 6x

C=cos(2e3x2+1)2e3x2+16x=12xe3x2+1cos(2e3x2+1)C' = \cos(2e^{3x^2+1}) \cdot 2 \cdot e^{3x^2+1} \cdot 6x = 12x\,e^{3x^2+1}\cos(2e^{3x^2+1})

d2ydx2=6e3x2+1sin(2e3x2+1)+6x6xe3x2+1sin(2e3x2+1)+6xe3x2+112xe3x2+1cos(2e3x2+1)\frac{d^2y}{dx^2} = 6e^{3x^2+1}\sin(2e^{3x^2+1}) + 6x \cdot 6x\,e^{3x^2+1}\sin(2e^{3x^2+1}) + 6x\,e^{3x^2+1} \cdot 12x\,e^{3x^2+1}\cos(2e^{3x^2+1})

=6e3x2+1sin(2e3x2+1)+36x2e3x2+1sin(2e3x2+1)+72x2e2(3x2+1)cos(2e3x2+1)= 6e^{3x^2+1}\sin(2e^{3x^2+1}) + 36x^2\,e^{3x^2+1}\sin(2e^{3x^2+1}) + 72x^2\,e^{2(3x^2+1)}\cos(2e^{3x^2+1})

At x=0x = 0: 3(0)2+1=13(0)^2 + 1 = 1So e1=ee^1 = e and 2e1=2e2e^{1} = 2e.

d2ydx2x=0=6esin(2e)+0+0=6esin(2e)\frac{d^2y}{dx^2}\bigg|_{x=0} = 6e\sin(2e) + 0 + 0 = 6e\sin(2e)

The common mistake: students forget the chain rule at the innermost level (3x2+13x^2 + 1) or mishandle the product rule when computing the second derivative.


UT-2: Implicit Differentiation with Product Rule on Mixed Terms

Section titled “UT-2: Implicit Differentiation with Product Rule on Mixed Terms”

Question:

Given x2y+sin(xy)=3x^2 y + \sin(xy) = 3Find d2ydx2\dfrac{d^2y}{dx^2} in terms of xx and yy.

Solution:

Differentiate both sides with respect to xx (remembering yy is a function of xx):

ddx[x2y]+ddx[sin(xy)]=0\frac{d}{dx}[x^2 y] + \frac{d}{dx}[\sin(xy)] = 0

2xy+x2y+cos(xy)(y+xy)=02xy + x^2 y' + \cos(xy) \cdot (y + xy') = 0

(x2+xcos(xy))y=(2xy+ycos(xy))(x^2 + x\cos(xy))y' = -(2xy + y\cos(xy))

y=2xy+ycos(xy)x2+xcos(xy)=y(2x+cos(xy))x(x+cos(xy))y' = -\frac{2xy + y\cos(xy)}{x^2 + x\cos(xy)} = -\frac{y(2x + \cos(xy))}{x(x + \cos(xy))}

For yy''Differentiate yy' using the quotient rule. Let u=y(2x+cos(xy))u = -y(2x + \cos(xy)) and v=x(x+cos(xy))v = x(x + \cos(xy)).

First, u=y(2x+cos(xy))y(2sin(xy)(y+xy))u' = -y'(2x + \cos(xy)) - y\left(2 - \sin(xy)(y + xy')\right).

v=(x+cos(xy))+x(1sin(xy)(y+xy))v' = (x + \cos(xy)) + x(1 - \sin(xy)(y + xy')).

y=uvuvv2y'' = \frac{u'v - uv'}{v^2}

This is extremely tedious but tests whether students correctly apply the product rule to the xyxy term inside sin(xy)\sin(xy)A common error point. The key misconception: students often write ddx[sin(xy)]=cos(xy)\frac{d}{dx}[\sin(xy)] = \cos(xy) instead of cos(xy)ddx[xy]=cos(xy)(y+xy)\cos(xy) \cdot \frac{d}{dx}[xy] = \cos(xy)(y + xy').


UT-3: Mean Value Theorem and Differentiability Implies Continuity

Section titled “UT-3: Mean Value Theorem and Differentiability Implies Continuity”

Question:

Let f(x)=x3=x1/3f(x) = \sqrt[3]{x} = x^{1/3}.

(a) Show that ff is continuous on [1,8][-1, 8]. (b) Show that ff satisfies the conclusion of the Mean Value Theorem on [1,8][-1, 8] by finding all values cc in (1,8)(-1, 8) such that f(c)=f(8)f(1)8(1)\displaystyle f'(c) = \frac{f(8) - f(-1)}{8 - (-1)}. (c) Identify the point where ff is not differentiable and explain why this does not contradict the MVT.

Solution:

(a) f(x)=x1/3f(x) = x^{1/3} is a root function, continuous on all of R\mathbb{R}So it is continuous on [1,8][-1, 8].

(b) f(8)f(1)8(1)=2(1)9=39=13\dfrac{f(8) - f(-1)}{8 - (-1)} = \dfrac{2 - (-1)}{9} = \dfrac{3}{9} = \dfrac{1}{3}.

f(x)=13x2/3=13x23f'(x) = \frac{1}{3}x^{-2/3} = \frac{1}{3\sqrt[3]{x^2}}

Set f(c)=13f'(c) = \frac{1}{3}:

13c23=13    c23=1    c2=1    c=±1\frac{1}{3\sqrt[3]{c^2}} = \frac{1}{3} \implies \sqrt[3]{c^2} = 1 \implies c^2 = 1 \implies c = \pm 1

Since we need c(1,8)c \in (-1, 8): c=1c = -1 is an endpoint, not in (1,8)(-1, 8). So the only solution is c=1c = 1.

(c) f(x)=13x23f'(x) = \dfrac{1}{3\sqrt[3]{x^2}} is undefined at x=0x = 0 (the denominator is zero). So ff is not differentiable at x=0x = 0.

This does not contradict the MVT because the MVT requires differentiability on the open interval (1,8)(-1, 8) and continuity on the closed interval [1,8][-1, 8]. Since 0(1,8)0 \in (-1, 8)The hypothesis of the MVT is actually not satisfied.

The fact that we found c=1c = 1 is a coincidence — the MVT conclusion happened to hold even though the hypothesis was not met. This is the key trap: the MVT gives a sufficient condition, not a necessary one. Students often incorrectly believe that finding such a cc proves the function satisfies the MVT hypotheses.


Tests synthesis of derivatives with other topics.

Section titled “IT-1: Related Rates with Geometric and Trigonometric Constraints (with Integrals)”

Question:

A 13-foot ladder leans against a vertical wall. The bottom of the ladder slides away from the wall at 2 ft/s. A point PP is located 5 feet from the top of the ladder (measured along the ladder).

(a) How fast is the top of the ladder sliding down the wall when the bottom is 5 feet from the wall? (b) Find the rate of change of the area of the triangle formed by the ladder, wall, and ground at the same instant. (c) The point PP traces a curve (a “ladder curve”). Set up (but do not evaluate) an integral for the arc length of this curve from the moment the ladder starts sliding (bottom at the wall) until the bottom is 5 feet from the wall.

Solution:

(a) Let xx = distance from wall to base, yy = height on wall. By Pythagoras: x2+y2=169x^2 + y^2 = 169.

Differentiating: 2xdxdt+2ydydt=02x\dfrac{dx}{dt} + 2y\dfrac{dy}{dt} = 0.

When x=5x = 5: y=16925=12y = \sqrt{169 - 25} = 12. Given dxdt=2\dfrac{dx}{dt} = 2:

2(5)(2) + 2(12)\frac{dy}{dt} = 0 \implies \frac{dy}{dt} = -\frac{10}{24} = -\frac{5}{12} \text{ ft/s

The negative sign confirms the top moves downward.

(b) Area A=12xyA = \dfrac{1}{2}xy. Differentiating:

\frac{dA}{dt} = \frac{1}{2}\left(x\frac{dy}{dt} + y\frac{dx}{dt}\right) = \frac{1}{2}\left(5 \cdot \left(-\frac{5}{12}\right) + 12 \cdot 2\right) = \frac{1}{2}\left(-\frac{25}{12} + 24\right) = \frac{1}{2} \cdot \frac{263}{12} = \frac{263}{24} \text{ ft^2\text{/s

(c) The point PP has coordinates. The bottom of the ladder is at (x,0)(x, 0) and the top at (0,y)(0, y) where y=169x2y = \sqrt{169 - x^2}. The point PP is 5 feet from the top, so measured from the bottom it is 135=813 - 5 = 8 feet along the ladder.

Px=x8x13=5x13,Py=8y13=8169x213P_x = x - \frac{8x}{13} = \frac{5x}{13}, \quad P_y = \frac{8y}{13} = \frac{8\sqrt{169-x^2}}{13}

The curve starts when x=0x = 0 (bottom at wall) and ends at x=5x = 5.

\text{Arc length = \int_0^5 \sqrt{\left(\frac{dP_x}{dx}\right)^2 + \left(\frac{dP_y}{dx}\right)^2} \, dx

dPxdx=513,dPydx=813x169x2\frac{dP_x}{dx} = \frac{5}{13}, \quad \frac{dP_y}{dx} = \frac{8}{13} \cdot \frac{-x}{\sqrt{169-x^2}}

\text{Arc length = \int_0^5 \sqrt{\frac{25}{169} + \frac{64x^2}{169(169-x^2)}} \, dx = \frac{1}{13}\int_0^5 \sqrt{\frac{25(169-x^2) + 64x^2}{169-x^2}} \, dx

=11305422525x2+64x2169x2dx=113054225+39x2169x2dx= \frac{1}{13}\int_0^5 \sqrt{\frac{4225 - 25x^2 + 64x^2}{169-x^2}} \, dx = \frac{1}{13}\int_0^5 \sqrt{\frac{4225 + 39x^2}{169 - x^2}} \, dx


IT-2: Optimization with Constraint Verification (with Integrals)

Section titled “IT-2: Optimization with Constraint Verification (with Integrals)”

Question:

Find the rectangle of maximum area that can be inscribed in the region bounded by y=4x2y = 4 - x^2 and y=0y = 0With one side on the xx-axis. Verify your answer is a maximum using the second derivative test, and then compute the area between the curve and the rectangle that is not covered by the rectangle.

Solution:

The parabola y=4x2y = 4 - x^2 intersects the xx-axis at x=±2x = \pm 2. A rectangle with base from a-a to aa (symmetry) on the xx-axis has height 4a24 - a^2.

Area: A(a)=2a(4a2)=8a2a3A(a) = 2a(4 - a^2) = 8a - 2a^3 for 0<a<20 \lt a \lt 2.

A(a)=86a2=0    a2=43    a=233A'(a) = 8 - 6a^2 = 0 \implies a^2 = \frac{4}{3} \implies a = \frac{2\sqrt{3}}{3}

A''(a) = -12a \lt 0 \text{ for a > 0

Since A ⁣(233)=12233=83<0A''\!\left(\frac{2\sqrt{3}}{3}\right) = -12 \cdot \frac{2\sqrt{3}}{3} = -8\sqrt{3} \lt 0This is a local maximum (and by endpoints, the global maximum on [0,2][0, 2]).

Maximum area: A ⁣(233)=2233(443)=43383=3239A\!\left(\frac{2\sqrt{3}}{3}\right) = 2 \cdot \frac{2\sqrt{3}}{3}\left(4 - \frac{4}{3}\right) = \frac{4\sqrt{3}}{3} \cdot \frac{8}{3} = \frac{32\sqrt{3}}{9}.

The area between the curve and the rectangle (the two “caps”):

\text{Uncovered area = 2\int_{\frac{2\sqrt{3}}{3}}^{2}(4 - x^2)\,dx = 2\left[4x - \frac{x^3}{3}\right]_{\frac{2\sqrt{3}}{3}}^{2}

=2((883)(83383381))=2(163833+8327)= 2\left(\left(8 - \frac{8}{3}\right) - \left(\frac{8\sqrt{3}}{3} - \frac{8 \cdot 3\sqrt{3}}{81}\right)\right) = 2\left(\frac{16}{3} - \frac{8\sqrt{3}}{3} + \frac{8\sqrt{3}}{27}\right)

=2(1637238327)=2(16364327)=323128327= 2\left(\frac{16}{3} - \frac{72\sqrt{3} - 8\sqrt{3}}{27}\right) = 2\left(\frac{16}{3} - \frac{64\sqrt{3}}{27}\right) = \frac{32}{3} - \frac{128\sqrt{3}}{27}


IT-3: Derivative of an Integral with Moving Bounds (with Integrals)

Section titled “IT-3: Derivative of an Integral with Moving Bounds (with Integrals)”

Question:

Let F(x)=x2x3t1+sin2tdt\displaystyle F(x) = \int_{x^2}^{x^3} \frac{t}{1 + \sin^2 t} \, dt. Find F(1)F'(1).

A student reasons: “By the Fundamental Theorem of Calculus, F(x)=x31+sin2(x3)x21+sin2(x2)F'(x) = \dfrac{x^3}{1 + \sin^2(x^3)} - \dfrac{x^2}{1 + \sin^2(x^2)}So F(1)=11+sin2111+sin21=0F'(1) = \dfrac{1}{1 + \sin^2 1} - \dfrac{1}{1 + \sin^2 1} = 0.”

Identify the error in the student’s reasoning and compute the correct value.

Solution:

The student forgot the chain rule. By the FTC with moving bounds:

F(x)=ddx[x3]x31+sin2(x3)ddx[x2]x21+sin2(x2)F'(x) = \frac{d}{dx}\left[x^3\right] \cdot \frac{x^3}{1 + \sin^2(x^3)} - \frac{d}{dx}\left[x^2\right] \cdot \frac{x^2}{1 + \sin^2(x^2)}

=3x2x31+sin2(x3)2xx21+sin2(x2)= 3x^2 \cdot \frac{x^3}{1 + \sin^2(x^3)} - 2x \cdot \frac{x^2}{1 + \sin^2(x^2)}

=3x51+sin2(x3)2x31+sin2(x2)= \frac{3x^5}{1 + \sin^2(x^3)} - \frac{2x^3}{1 + \sin^2(x^2)}

At x=1x = 1:

F(1)=31+sin2121+sin21=11+sin21F'(1) = \frac{3}{1 + \sin^2 1} - \frac{2}{1 + \sin^2 1} = \frac{1}{1 + \sin^2 1}

The common misconception: students apply FTC part 1 without the chain rule when the bounds are functions of xx rather than xx itself. The correct formula is:

ddxa(x)b(x)f(t)dt=f(b(x))b(x)f(a(x))a(x)\frac{d}{dx}\int_{a(x)}^{b(x)} f(t)\,dt = f(b(x)) \cdot b'(x) - f(a(x)) \cdot a'(x)

The key principles covered in this topic are linked in the sub-pages above. Focus on understanding the definitions, applying the formulas or frameworks, and evaluating strengths and limitations of each approach.

Worked examples demonstrating the application of key concepts are covered in the detailed sub-pages linked above.

  • Confusing terminology or concepts that appear similar but have distinct meanings.
  • Overlooking key assumptions or boundary conditions that limit applicability.