Skip to content

Integrals -- Diagnostic Tests

Integrals — Diagnostic Tests

Unit Tests

Tests edge cases, boundary conditions, and common misconceptions for integrals.

UT-1: Riemann Sum Identification and Limit Conversion

Question:

A student encounters the limit:

limnk=1nk2n34k2n2\lim_{n \to \infty} \sum_{k=1}^{n} \frac{k^2}{n^3} \sqrt{4 - \frac{k^2}{n^2}}

(a) Express this limit as a definite integral. (b) Identify which type of Riemann sum (left, right, midpoint, or trapezoidal) this represents, or state if it is ambiguous. (c) Evaluate the definite integral.

Solution:

(a) Factor out 1n\frac{1}{n}:

k=1nk2n34k2n2=k=1n1n(kn)24(kn)2\sum_{k=1}^{n} \frac{k^2}{n^3}\sqrt{4 - \frac{k^2}{n^2}} = \sum_{k=1}^{n} \frac{1}{n} \cdot \left(\frac{k}{n}\right)^2 \sqrt{4 - \left(\frac{k}{n}\right)^2}

With Δx=1n\Delta x = \frac{1}{n} and xk=knx_k = \frac{k}{n} (right endpoint of the kk-th subinterval on [0,1][0, 1]):

limnk=1n1nxk24xk2=01x24x2dx\lim_{n \to \infty} \sum_{k=1}^{n} \frac{1}{n} \cdot x_k^2 \sqrt{4 - x_k^2} = \int_0^1 x^2\sqrt{4 - x^2}\,dx

(b) Since xk=knx_k = \frac{k}{n} uses the right endpoint of each subinterval, this is a right Riemann sum.

(c) Use the substitution x=2sinθx = 2\sin\theta, dx=2cosθdθdx = 2\cos\theta\,d\theta:

01x24x2dx=0arcsin(1/2)4sin2θ2cosθ2cosθdθ\int_0^1 x^2\sqrt{4-x^2}\,dx = \int_0^{\arcsin(1/2)} 4\sin^2\theta \cdot 2\cos\theta \cdot 2\cos\theta\,d\theta

=160π/6sin2θcos2θdθ=40π/6sin2(2θ)dθ= 16\int_0^{\pi/6} \sin^2\theta\cos^2\theta\,d\theta = 4\int_0^{\pi/6} \sin^2(2\theta)\,d\theta

Using sin2(2θ)=1cos(4θ)2\sin^2(2\theta) = \frac{1 - \cos(4\theta)}{2}:

=40π/61cos(4θ)2dθ=2[θsin(4θ)4]0π/6= 4\int_0^{\pi/6}\frac{1 - \cos(4\theta)}{2}\,d\theta = 2\left[\theta - \frac{\sin(4\theta)}{4}\right]_0^{\pi/6}

=2(π6sin(2π/3)4)=2(π63/24)=π334= 2\left(\frac{\pi}{6} - \frac{\sin(2\pi/3)}{4}\right) = 2\left(\frac{\pi}{6} - \frac{\sqrt{3}/2}{4}\right) = \frac{\pi}{3} - \frac{\sqrt{3}}{4}


UT-2: Integration by Parts with LIATE Trap

Question:

Evaluate e2xsin(3x)dx\displaystyle\int e^{2x}\sin(3x)\,dx.

A student chooses u=sin(3x)u = \sin(3x) and dv=e2xdxdv = e^{2x}\,dx for the first application of integration by parts. Show that this choice works but leads to a longer computation than choosing u=e2xu = e^{2x}. Evaluate the integral completely using the more efficient choice and explain why “LIATE” alone does not settle this choice.

Solution:

LIATE ranks: Logarithmic, Inverse trig, Algebraic, Trigonometric, Exponential. Both e2xe^{2x} (Exponential) and sin(3x)\sin(3x) (Trigonometric) are in the LIATE list. Trigonometric comes before Exponential, so LIATE suggests u=sin(3x)u = \sin(3x). But for products of exponentials and trig functions, either choice works, and the key is to apply integration by parts twice and solve algebraically.

Using u=e2xu = e^{2x}, dv=sin(3x)dxdv = \sin(3x)\,dx:

du=2e2xdxdu = 2e^{2x}\,dx, v=13cos(3x)v = -\frac{1}{3}\cos(3x).

e2xsin(3x)dx=13e2xcos(3x)+23e2xcos(3x)dx\int e^{2x}\sin(3x)\,dx = -\frac{1}{3}e^{2x}\cos(3x) + \frac{2}{3}\int e^{2x}\cos(3x)\,dx

Apply parts again to the remaining integral. Let u=e2xu = e^{2x}, dv=cos(3x)dxdv = \cos(3x)\,dx:

du=2e2xdxdu = 2e^{2x}\,dx, v=13sin(3x)v = \frac{1}{3}\sin(3x).

e2xcos(3x)dx=13e2xsin(3x)23e2xsin(3x)dx\int e^{2x}\cos(3x)\,dx = \frac{1}{3}e^{2x}\sin(3x) - \frac{2}{3}\int e^{2x}\sin(3x)\,dx

Substituting back:

I=13e2xcos(3x)+23(13e2xsin(3x)23I)I = -\frac{1}{3}e^{2x}\cos(3x) + \frac{2}{3}\left(\frac{1}{3}e^{2x}\sin(3x) - \frac{2}{3}I\right)

I=13e2xcos(3x)+29e2xsin(3x)49II = -\frac{1}{3}e^{2x}\cos(3x) + \frac{2}{9}e^{2x}\sin(3x) - \frac{4}{9}I

139I=e2x(13cos(3x)+29sin(3x))\frac{13}{9}I = e^{2x}\left(-\frac{1}{3}\cos(3x) + \frac{2}{9}\sin(3x)\right)

I=e2x13(2sin(3x)3cos(3x))+CI = \frac{e^{2x}}{13}(2\sin(3x) - 3\cos(3x)) + C

The misconception: students sometimes stop after one application of parts, or they choose a different assignment for the second integration by parts (switching uu and dvdv), which creates a circular argument instead of solving for II.


UT-3: Area Between Curves When Functions Cross the x-Axis

Question:

Find the total area of the region bounded by y=x34xy = x^3 - 4x and y=x24y = x^2 - 4.

A student computes 22[(x34x)(x24)]dx\displaystyle\int_{-2}^{2}\left[(x^3 - 4x) - (x^2 - 4)\right]\,dx and gets the wrong answer. Explain the error and compute the correct total area.

Solution:

First find intersection points: x34x=x24    x3x24x+4=0x^3 - 4x = x^2 - 4 \implies x^3 - x^2 - 4x + 4 = 0.

By inspection x=1x = 1 is a root: 114+4=01 - 1 - 4 + 4 = 0. Factoring:

(x1)(x24)=(x1)(x2)(x+2)=0(x-1)(x^2 - 4) = (x-1)(x-2)(x+2) = 0

Intersection points: x=2,1,2x = -2, 1, 2.

The student’s error: they integrated from 2-2 to 22 without accounting for the curve crossing at x=1x = 1. On [2,1][-2, 1]We must determine which curve is on top; on [1,2][1, 2]The other may be on top.

Test point x=0x = 0: x34x=0x^3 - 4x = 0, x24=4x^2 - 4 = -4. So x34x>x24x^3 - 4x \gt x^2 - 4 on [2,1][-2, 1].

Test point x=1.5x = 1.5: x34x=3.3756=2.625x^3 - 4x = 3.375 - 6 = -2.625, x24=2.254=1.75x^2 - 4 = 2.25 - 4 = -1.75. So x24>x34xx^2 - 4 \gt x^3 - 4x on [1,2][1, 2].

\text{Total area = \int_{-2}^{1}\left[(x^3 - 4x) - (x^2 - 4)\right]\,dx + \int_1^{2}\left[(x^2 - 4) - (x^3 - 4x)\right]\,dx

=21(x3x24x+4)dx+12(x3+x2+4x4)dx= \int_{-2}^{1}(x^3 - x^2 - 4x + 4)\,dx + \int_1^{2}(-x^3 + x^2 + 4x - 4)\,dx

First integral:

[x44x332x2+4x]21=(14132+4)(4+8388)\left[\frac{x^4}{4} - \frac{x^3}{3} - 2x^2 + 4x\right]_{-2}^{1} = \left(\frac{1}{4} - \frac{1}{3} - 2 + 4\right) - \left(4 + \frac{8}{3} - 8 - 8\right)

=2512(203)=2512+8012=10512=354= \frac{25}{12} - \left(-\frac{20}{3}\right) = \frac{25}{12} + \frac{80}{12} = \frac{105}{12} = \frac{35}{4}

Second integral:

[x44+x33+2x24x]12=(4+83+88)(14+13+24)\left[-\frac{x^4}{4} + \frac{x^3}{3} + 2x^2 - 4x\right]_1^{2} = \left(-4 + \frac{8}{3} + 8 - 8\right) - \left(-\frac{1}{4} + \frac{1}{3} + 2 - 4\right)

=43(2312)=1612+2312=712= -\frac{4}{3} - \left(-\frac{23}{12}\right) = -\frac{16}{12} + \frac{23}{12} = \frac{7}{12}

\text{Total area = \frac{35}{4} + \frac{7}{12} = \frac{105 + 7}{12} = \frac{112}{12} = \frac{28}{3}

The student’s integral gives 22(x3x24x+4)dx=283\displaystyle\int_{-2}^{2}(x^3 - x^2 - 4x + 4)\,dx = \frac{28}{3} only because the areas happen to be positive in both subintervals when separated correctly. The student’s single integral from 2-2 to 22 actually evaluates to:

22(x3x24x+4)dx=[x44x332x2+4x]22\int_{-2}^{2}(x^3 - x^2 - 4x + 4)\,dx = \left[\frac{x^4}{4} - \frac{x^3}{3} - 2x^2 + 4x\right]_{-2}^{2}

This gives 283\frac{28}{3} here too, but this is coincidental. The fundamental error is not splitting at intersection points, which would give wrong answers .


Integration Tests

Tests synthesis of integrals with other topics.

IT-1: Volume of Revolution with Washer and Shell Method Verification (with Derivatives)

Question:

Let RR be the region bounded by y=xy = \sqrt{x}, y=0y = 0And x=4x = 4.

(a) Find the volume generated when RR is revolved about the line x=6x = 6 using the shell method. (b) Verify your answer using the washer method. (c) A student claims the volume about x=6x = 6 should be the same as the volume about the yy-axis because “it’s just a translation.” Explain why this is false, and compute the volume about the yy-axis for comparison.

Solution:

(a) Shell method (parallel to axis of revolution): use horizontal shells.

A shell at height yy has radius r=6x=6y2r = 6 - x = 6 - y^2 and height h=dyh = dy (thin strip). For shells, we integrate along the axis perpendicular to the axis of revolution.

Since we revolve about x=6x = 6 (vertical line), shells are vertical: radius =6x= 6 - xHeight =x0=x= \sqrt{x} - 0 = \sqrt{x}.

V=2π04(6x)xdx=2π04(6x1/2x3/2)dxV = 2\pi\int_0^4 (6-x)\sqrt{x}\,dx = 2\pi\int_0^4 (6x^{1/2} - x^{3/2})\,dx

=2π[4x3/225x5/2]04=2π(482532)=2π(32645)=2π965=192π5= 2\pi\left[4x^{3/2} - \frac{2}{5}x^{5/2}\right]_0^4 = 2\pi\left(4 \cdot 8 - \frac{2}{5} \cdot 32\right) = 2\pi\left(32 - \frac{64}{5}\right) = 2\pi \cdot \frac{96}{5} = \frac{192\pi}{5}

(b) Washer method: washers perpendicular to x=6x = 6So we integrate with respect to yy.

Outer radius: R=60=6R = 6 - 0 = 6 (from x=6x = 6 to the yy-axis). More precisely, for washers perpendicular to the axis x=6x = 6: at height yyThe region extends from x=y2x = y^2 to x=4x = 4. Revolved about x=6x = 6:

  • Outer radius: 6y26 - y^2 (from axis to the left edge of region at x=y2x = y^2)
  • Inner radius: 64=26 - 4 = 2 (from axis to the right edge of region at x=4x = 4)

V=π02[(6y2)222]dy=π02(3612y2+y44)dyV = \pi\int_0^2\left[(6-y^2)^2 - 2^2\right]\,dy = \pi\int_0^2(36 - 12y^2 + y^4 - 4)\,dy

=π02(3212y2+y4)dy=π[32y4y3+y55]02= \pi\int_0^2(32 - 12y^2 + y^4)\,dy = \pi\left[32y - 4y^3 + \frac{y^5}{5}\right]_0^2

=π(6432+325)=π(32+325)=192π5= \pi\left(64 - 32 + \frac{32}{5}\right) = \pi\left(32 + \frac{32}{5}\right) = \frac{192\pi}{5}

(c) Volume about the yy-axis (disk method):

V=π04(x)2dx=π04xdx=π8=8πV = \pi\int_0^4 (\sqrt{x})^2\,dx = \pi\int_0^4 x\,dx = \pi \cdot 8 = 8\pi

The volumes are different (192π5120.6\frac{192\pi}{5} \approx 120.6 vs 8π25.18\pi \approx 25.1). Revolving about a different axis changes the radius of every point, so the volume changes. The student’s “translation” argument is wrong because the region itself does not translate — only the axis does, which changes the distance from every point to the axis.


IT-2: Improper Integral Convergence with Parameter (with Limits)

Question:

For what values of pp does the improper integral 0xp11+xdx\displaystyle\int_0^{\infty} \frac{x^{p-1}}{1 + x}\,dx converge?

Hint: Split the integral at x=1x = 1 and analyze the behavior of each part separately using comparison with pp-integrals.

Solution:

Split at x=1x = 1: 0xp11+xdx=01xp11+xdx+1xp11+xdx\displaystyle\int_0^{\infty} \frac{x^{p-1}}{1+x}\,dx = \int_0^1 \frac{x^{p-1}}{1+x}\,dx + \int_1^{\infty} \frac{x^{p-1}}{1+x}\,dx

Near x=0x = 0 (first integral): When x(0,1)x \in (0, 1), 12<11+x<1\frac{1}{2} \lt \frac{1}{1+x} \lt 1So:

xp12<xp11+x<xp1\frac{x^{p-1}}{2} \lt \frac{x^{p-1}}{1+x} \lt x^{p-1}

By comparison with 01xp1dx\displaystyle\int_0^1 x^{p-1}\,dx (converges iff p1>1p - 1 > -1I.e., p>0p > 0):

The first integral converges iff p>0p > 0.

As xx \to \infty (second integral): When x>1x > 1, 12<11+x<1x\frac{1}{2} \lt \frac{1}{1+x} \lt \frac{1}{x}So:

xp12<xp11+x<xp2\frac{x^{p-1}}{2} \lt \frac{x^{p-1}}{1+x} \lt x^{p-2}

By comparison with 1xp2dx\displaystyle\int_1^{\infty} x^{p-2}\,dx (converges iff p2<1p - 2 \lt -1I.e., p<1p \lt 1):

The second integral converges iff p<1p \lt 1.

Conclusion: The full integral converges iff both parts converge, i.e., 0<p<10 \lt p \lt 1.

Note: this integral equals B(p,1p)=πcsc(πp)B(p, 1-p) = \pi \csc(\pi p) (the beta function), which has the same domain of convergence.


IT-3: FTC Part 1 vs Part 2 Confusion with Piecewise Functions (with Continuity)

Question:

Let f(x) = \begin{cases} 2x & \text{if 0 \leq x \lt 2 \\ 8 - 2x & \text{if 2 \leq x \leq 4 \end{cases}

Let F(x)=0xf(t)dt\displaystyle F(x) = \int_0^x f(t)\,dt.

(a) Find and graph F(x)F(x). (b) Is FF differentiable at x=2x = 2? Compute F(2)F'(2) from the definition of the derivative and explain. (c) A student claims that since ff has a corner at x=2x = 2, FF must also have a corner at x=2x = 2. Is this correct?

Solution:

(a) For 0x<20 \leq x \lt 2:

F(x)=0x2tdt=t20x=x2F(x) = \int_0^x 2t\,dt = t^2\Big|_0^x = x^2

For 2x42 \leq x \leq 4:

F(x)=022tdt+2x(82t)dt=4+[8tt2]2x=4+(8xx212)=x2+8x8F(x) = \int_0^2 2t\,dt + \int_2^x (8 - 2t)\,dt = 4 + \left[8t - t^2\right]_2^x = 4 + (8x - x^2 - 12) = -x^2 + 8x - 8

So F(x) = \begin{cases} x^2 & \text{if 0 \leq x \lt 2 \\ -x^2 + 8x - 8 & \text{if 2 \leq x \leq 4 \end{cases}

(Note: 4+(8xx212)=x2+8x84 + (8x - x^2 - 12) = -x^2 + 8x - 8Not (x4)2=x28x+16(x-4)^2 = x^2 - 8x + 16. The two expressions differ.)

(b) Check differentiability at x=2x = 2:

F(2)=4+168=4F(2) = -4 + 16 - 8 = 4

Left-hand derivative: F(2)=limh0F(2+h)F(2)h=limh0(2+h)24h=limh04h+h2h=4F'_{-}(2) = \lim_{h \to 0^-}\frac{F(2+h) - F(2)}{h} = \lim_{h \to 0^-}\frac{(2+h)^2 - 4}{h} = \lim_{h \to 0^-}\frac{4h + h^2}{h} = 4.

Right-hand derivative: F+(2)=limh0+F(2+h)F(2)h=limh0+(2+h)2+8(2+h)84hF'_{+}(2) = \lim_{h \to 0^+}\frac{F(2+h) - F(2)}{h} = \lim_{h \to 0^+}\frac{-(2+h)^2 + 8(2+h) - 8 - 4}{h}

=limh0+44hh2+16+8h12h=limh0+h2+4hh=limh0+(h+4)=4= \lim_{h \to 0^+}\frac{-4 - 4h - h^2 + 16 + 8h - 12}{h} = \lim_{h \to 0^+}\frac{-h^2 + 4h}{h} = \lim_{h \to 0^+}(-h + 4) = 4.

Since 4=44 = 4, FF is differentiable at x=2x = 2With F(2)=4=f(2)F'(2) = 4 = f(2).

(c) The student is incorrect. Although ff has a corner at x=2x = 2 (ff changes from slope +2+2 to slope 2-2), ff is continuous at x=2x = 2 (f(2)=4=f(2+)f(2^-) = 4 = f(2^+)). By FTC part 1, since ff is continuous at x=2x = 2, FF is differentiable at x=2x = 2 with F(2)=f(2)=4F'(2) = f(2) = 4. Integration “smooths” the corner: FF is continuously differentiable even though ff is not.

Summary

The key principles covered in this topic are linked in the sub-pages above. Focus on understanding the definitions, applying the formulas or frameworks, and evaluating strengths and limitations of each approach.

Worked Examples

Worked examples demonstrating the application of key concepts are covered in the detailed sub-pages linked above.

Common Pitfalls

  • Confusing terminology or concepts that appear similar but have distinct meanings.
  • Overlooking key assumptions or boundary conditions that limit applicability.