Skip to content

Software Design and Development

Software Design and Development

Higher Software Design

Software Development Process

Waterfall Model: A linear sequential approach where each phase must be completed before the next Begins.

  1. Requirements analysis: Gather and document what the software must do
  2. Design: Plan the software architecture, data structures, and algorithms
  3. Implementation: Write the code
  4. Testing: Verify the software meets requirements
  5. Deployment: Release the software
  6. Maintenance: Fix bugs and add features

Agile Methodologies: Iterative and incremental approaches that embrace change.

Scrum: Uses sprints ( 2-4 weeks), daily stand-ups, sprint reviews, and retrospectives. Roles: Product Owner, Scrum Master, Development Team.

Extreme Programming (XP): Emphasises pair programming, test-driven development, continuous Integration, and frequent small releases.

Waterfall vs Agile comparison:

FeatureWaterfallAgile
ApproachLinear, sequentialIterative, incremental
FlexibilityRigidFlexible, embraces change
Customer involvementAt start/endContinuous
DeliverySingle release at endFrequent small releases
DocumentationExtensive upfrontMinimal, working code
RiskHigh (late testing)Low (early testing)
Best forWell-understood projectsEvolving requirements

Analysis and Design

Requirements gathering techniques:

  • Interviews with stakeholders
  • Observation of current systems
  • Questionnaires
  • Document analysis
  • Prototyping

Feasibility study: Evaluates whether a project is worth undertaking. Considers:

  • Technical feasibility
  • Economic feasibility
  • Operational feasibility
  • Schedule feasibility

Functional requirements: What the system must do (e.g., “The system shall allow users to Register an account”).

Non-functional requirements: How the system should perform (e.g., “The system shall respond Within 2 seconds”).

Worked Example. For a school library system, identify three functional and three non-functional Requirements.

Functional: (1) The system shall allow librarians to add new books. (2) The system shall track which Books are currently on loan. (3) The system shall generate overdue reports.

Non-functional: (1) The system shall respond to search queries within 1 second. (2) The system shall Support at least 50 concurrent users. (3) The system shall be available 99.5% of the time.

Data Modelling

Entity-Relationship Diagrams (ERDs):

Show entities (tables), attributes, and relationships between them.

Relationship types:

  • One-to-one (1:1)
  • One-to-many (1:M)
  • Many-to-many (M:N) — requires a junction table

Example: A school database with Students, Courses, and Enrolments.

  • Student (1) — (M) Enrolment (M) — (1) Course

Unified Modelling Language (UML)

Use Case Diagrams:

  • Actors (users or external systems)
  • Use cases (functions the system performs)
  • System boundary

Class Diagrams:

  • Classes with attributes and methods
  • Relationships: association, aggregation, composition, inheritance
  • Visibility: + (public), - (private), # (protected)

Example:

+-------------------+
| Animal |
+-------------------+
| - name: String |
| - age: Integer |
+-------------------+
| + eat(): void |
| + sleep(): void |
+-------------------+
|
| (inheritance)
|
+-------------------+
| Dog |
+-------------------+
| - breed: String |
+-------------------+
| + bark(): void |
| + fetch(): void |
+-------------------+

Sequence Diagrams: Show the interaction between objects over time. Include lifelines, activation Bars, and messages.

Algorithms and Pseudocode

Standard pseudocode conventions:

BEGIN
INPUT name
INPUT age
IF age >= 18 THEN
OUTPUT "Welcome, " + name
ELSE
OUTPUT "Access denied"
END IF
END

Example: Linear search.

FUNCTION linear_search(array, target)
FOR i FROM 0 TO length(array) - 1
IF array[i] = target THEN
RETURN i
END IF
END FOR
RETURN -1
END FUNCTION

Time complexity: O(n)O(n) — in the worst case, every element is checked.


Software Development

Programming Paradigms

Imperative Programming: Sequence of commands that change the program state. The programmer Specifies how to solve the problem step by step.

Object-Oriented Programming (OOP): Based on objects that contain data (attributes) and behaviour (methods).

Four pillars of OOP:

  1. Encapsulation: Bundling data and methods together; hiding internal details through access modifiers.

  2. Inheritance: Creating new classes from existing ones, inheriting their attributes and methods.

  3. Polymorphism: The ability of objects to take on different forms. Method overriding (runtime) and method overloading (compile-time).

  4. Abstraction: Hiding complex implementation details and exposing only essential features.

Example (Python):

class Shape:
def area(self):
raise NotImplementedError
class Rectangle(Shape):
def __init__(self, width, height):
self.width = width
self.height = height
def area(self):
return self.width * self.height
class Circle(Shape):
def __init__(self, radius):
self.radius = radius
def area(self):
return 3.14159 * self.radius ** 2
shapes = [Rectangle(4, 5), Circle(3)]
for shape in shapes:
print(shape.area())

Worked Example (Python inheritance):

class Vehicle:
def __init__(self, make, model, year):
self.make = make
self.model = model
self.year = year
def describe(self):
return f"{self.year} {self.make} {self.model}"
class Car(Vehicle):
def __init__(self, make, model, year, doors):
super().__init__(make, model, year)
self.doors = doors
def describe(self):
return f"{super().describe()} ({self.doors}-door)"

Functional Programming: Based on mathematical functions. Emphasises immutability, pure Functions, and higher-order functions.

Key concepts:

  • Pure functions: Same output for same input; no side effects
  • First-class functions: Functions can be passed as arguments and returned as values
  • Higher-order functions: Functions that take or return other functions
  • Recursion: Functions that call themselves instead of using loops
  • Immutable data: Data cannot be modified after creation

Example (Haskell):

factorial :: Integer -> Integer
factorial 0 = 1
factorial n = n * factorial (n - 1)
map' :: (a -> b) -> [a] -> [b]
map' _ [] = []
map' f (x:xs) = f x : map' f xs
sumEven :: [Int] -> Int
sumEven xs = sum (filter even xs)

Data Types and Structures

Primitive data types: Integer, Real/Float, Boolean, Character, String.

Composite data types: Arrays, records, lists, tuples.

Abstract Data Types (ADTs):

  • Stack: LIFO (Last In, First Out)
  • Queue: FIFO (First In, First Out)
  • Linked list
  • Binary tree
  • Hash table

Example (Python stack):

class Stack:
def __init__(self):
self._items = []
def push(self, item):
self._items.append(item)
def pop(self):
if self.is_empty():
raise IndexError("Stack is empty")
return self._items.pop()
def peek(self):
if self.is_empty():
raise IndexError("Stack is empty")
return self._items[-1]
def is_empty(self):
return len(self._items) == 0
def size(self):
return len(self._items)

Example (Python queue):

from collections import deque
class Queue:
def __init__(self):
self._items = deque()
def enqueue(self, item):
self._items.append(item)
def dequeue(self):
if self.is_empty():
raise IndexError("Queue is empty")
return self._items.popleft()
def peek(self):
if self.is_empty():
raise IndexError("Queue is empty")
return self._items[0]
def is_empty(self):
return len(self._items) == 0
def size(self):
return len(self._items)

ADT complexity comparison:

OperationStackQueueArrayLinked List
Push/EnqueueO(1)O(1)O(1)O(1)N/AO(1)O(1)
Pop/DequeueO(1)O(1)O(1)O(1)N/AO(1)O(1)
Peek/FrontO(1)O(1)O(1)O(1)N/AO(1)O(1)
SearchO(n)O(n)O(n)O(n)O(n)O(n)O(n)O(n)
Access by indexN/AN/AO(1)O(1)O(n)O(n)
Insert middleN/AN/AO(n)O(n)O(1)O(1) with pointer

File Handling

Sequential files: Records stored one after another. Read from beginning to end.

Random-access files: Records can be accessed directly by their position.

Example (Python):

with open("data.txt", "w") as f:
f.write("Hello, World!\n")
f.write("Second line\n")
with open("data.txt", "r") as f:
for line in f:
print(line.strip())
with open("data.txt", "a") as f:
f.write("Third line\n")

Error Handling

Types of errors:

  • Syntax errors: Code does not follow the language rules
  • Logic errors: Code runs but produces incorrect results
  • Runtime errors: Code crashes during execution

Exception handling (Python):

try:
numerator = int(input("Enter numerator: "))
denominator = int(input("Enter denominator: "))
result = numerator / denominator
print(f"Result: {result}")
except ValueError:
print("Please enter valid integers.")
except ZeroDivisionError:
print("Cannot divide by zero.")
finally:
print("Program complete.")

Testing

Test strategies:

  • Unit testing: Testing individual components in isolation
  • Integration testing: Testing how components work together
  • System testing: Testing the complete system
  • Acceptance testing: User verifies the system meets requirements

Black-box testing: Testing based on specifications without knowing the internal code. Uses Equivalence partitioning and boundary value analysis.

White-box testing: Testing based on the internal structure and logic of the code.

Example: For a function that accepts ages 0-120:

  • Equivalence classes: 0-120 (valid), less than 0 (invalid), greater than 120 (invalid)
  • Boundary values: -1, 0, 1, 119, 120, 121

Worked Example. A function calculates a discount based on quantity: 0-9 items (no discount), 10-49 items (5% discount), 50+ items (10% discount). Identify the boundary values.

Boundaries: 0, 1, 9, 10, 11, 49, 50, 51. Test values at and on either side of each boundary.

Additional Design Topics

Software Design Principles

SOLID Principles (Higher):

  1. Single Responsibility: A class should have only one reason to change.
  2. Open/Closed: Classes should be open for extension but closed for modification.
  3. Liskov Substitution: Subtypes must be substitutable for their base types.
  4. Interface Segregation: Many specific interfaces are better than one general interface.
  5. Dependency Inversion: Depend on abstractions, not concretions.

Cohesion: How closely related the responsibilities of a module are. High cohesion is desirable.

Coupling: How much modules depend on each other. Low coupling is desirable.

Design GoalDesirableEffect
High cohesionYesEasier to understand and modify
Low couplingYesChanges in one module have less impact

Worked Example. A class CustomerManager handles customer data, sends emails, and generates Reports. This has low cohesion. Refactor by splitting into CustomerData``EmailServiceAnd ReportGenerator.

Sequence Diagrams

Sequence diagrams show the interaction between objects over time.

Example: User borrows a book from the library.

User -> LibrarySystem: borrowBook(userID, bookID)
LibrarySystem -> Database: checkAvailability(bookID)
Database --> LibrarySystem: available = true
LibrarySystem -> Database: createLoan(userID, bookID)
Database --> LibrarySystem: loanCreated
LibrarySystem --> User: "Book borrowed successfully"

State Transition Diagrams

Show how an object moves between states in response to events.

Example: Order states

[New] --place--> [Processing] --ship--> [Shipped] --deliver--> [Delivered]
| |
+---cancel--> [Cancelled] |
| |
+---return--<------------------------+

Additional Programming Topics

Functional Programming in Detail (Higher)

Key concepts:

  • Pure functions: Same output for same input; no side effects.
  • First-class functions: Functions can be passed as arguments and returned as values.
  • Higher-order functions: Functions that take or return other functions.
  • Recursion: Functions that call themselves instead of using loops.
  • Immutable data: Data cannot be modified after creation.

Map, Filter, Reduce:

FunctionPurposeExample (Haskell)
mapApply a function to each elementmap (*2) [1,2,3] = [2,4,6]
filterKeep elements matching a predicatefilter even [1..10]
reduceCombine elements into a single valuesum [1,2,3,4] = 10

Haskell examples:

-- Map: double each element
doubleAll xs = map (*2) xs
-- Filter: keep even numbers
keepEven xs = filter even xs
-- Reduce: sum all elements
sumList xs = foldl (+) 0 xs
-- Composition: square then filter even
process xs = filter even (map (^2) xs)

Exception Handling in Detail

Exception hierarchy:

try:
result = 10 / 0
except ZeroDivisionError:
print("Cannot divide by zero")
except (TypeError, ValueError) as e:
print(f"Error: {e}")
except Exception as e:
print(f"Unexpected error: {e}")
finally:
print("Cleanup code runs here")

Best practices:

  • Catch specific exceptions, not bare except:.
  • Use finally for cleanup (closing files, releasing resources).
  • Do not silently suppress exceptions.

Data Validation Techniques

CheckDescriptionExample
Range checkValue within acceptable range0 <= age <= 120
Type checkValue is the correct data typeisinstance(age, int)
Length checkString has correct number of characterslen(name) <= 50
Format checkData matches expected patternemail contains @ and .
Presence checkField is not emptyname != ""
Lookup checkValue exists in a reference tablecountry in valid_countries

Worked Example. Write a Python function that validates a password.

def validate_password(password):
if len(password) < 8:
return False, "Password must be at least 8 characters."
if not any(c.isupper() for c in password):
return False, "Password must contain an uppercase letter."
if not any(c.islower() for c in password):
return False, "Password must contain a lowercase letter."
if not any(c.isdigit() for c in password):
return False, "Password must contain a digit."
return True, "Password is valid."

Additional Practice Questions

  1. Explain the difference between high cohesion and low coupling. Why are both desirable?

  2. Design a sequence diagram for a user logging into a system. Include the user, the web server, the database, and the authentication service.

  3. Write a Haskell function that takes a list of integers and returns a new list containing only the positive even numbers.

  4. Explain the SOLID principles. Give an example of violating the Single Responsibility Principle and show how to fix it.

  5. Write a Python class BankAccount with methods for deposit, withdraw, and get_balance. Include validation (no negative deposits, no overdrafts).

  6. Explain the difference between a state transition diagram and a sequence diagram. When would you use each?

  7. Write pseudocode for a function that validates an email address. Check for the presence of @ and at least one . After the @.

  8. Explain why functional programming is becoming more popular. Give two advantages and two disadvantages compared to imperative programming.

  9. Design a class diagram for an online shopping system with classes for User, Product, Order, and OrderItem. Show relationships and key attributes.

  10. Write a Python function that implements merge sort. Include comments explaining each step.

  11. Explain what test-driven development (TDD) is. Describe the red-green-refactor cycle.

  12. A function calculateDiscount(price, customerType) applies discounts: students get 10%, staff get 20%, everyone else gets 5% on orders over 100 pounds. Using boundary value analysis, identify all test cases.

Additional Testing Topics

Test-Driven Development (TDD)

TDD is a development methodology where tests are written before the code.

The TDD cycle (Red-Green-Refactor):

  1. Red: Write a failing test for the desired functionality.
  2. Green: Write the minimum code to make the test pass.
  3. Refactor: Improve the code while keeping tests green.

Benefits:

  • Forces clear thinking about requirements before coding.
  • Produces a comprehensive test suite.
  • Gives confidence that changes do not break existing functionality.
  • Results in modular, testable code.

Example:

# Red: Write the test first
def test_add():
assert add(2, 3) == 5
assert add(-1, 1) == 0
assert add(0, 0) == 0
# Green: Write minimum code
def add(a, b):
return a + b
# Refactor: Improve if needed (not much to refactor here)

Code Quality Metrics

MetricDescription
Cyclomatic complexityNumber of independent paths through code (lower is better)
Code coveragePercentage of code exercised by tests (higher is better)
Lines of codeTotal lines (lower is generally better for the same functionality)
Technical debtCost of future work caused by shortcuts taken now

Debugging Strategies

  1. Print statements: Insert print/println to trace variable values.
  2. Breakpoints: Pause execution at a specific line (using a debugger).
  3. Stepping: Execute code one line at a time.
  4. Watch variables: Monitor specific variables as code executes.
  5. Binary search: Comment out half the code to isolate the bug.

Software Licensing

LicenseDescription
ProprietarySource code is closed; usage restricted by EULA
Open sourceSource code is available; usage governed by license
GPLDerivative works must also be open source
MITPermissive; can use, modify, and distribute freely
ApachePermissive; requires attribution and license notice

Additional Practice Questions

  1. Write a Python function that implements a linked list with append, delete, and search methods. What is the time complexity of each?

  2. Explain the difference between a syntax error, a logic error, and a runtime error. Give a Python example of each.

  3. Design a test plan for a vending machine program. Include test cases for normal operation, boundary conditions, and error handling.

  4. Explain three advantages of test-driven development. Give a scenario where TDD would be particularly beneficial.

  5. Write a Python decorator that measures the execution time of a function.

  6. Compare the waterfall and agile methodologies. For each, give a type of project where it is the better choice.

  7. Explain what cyclomatic complexity is and why keeping it low is important.

  8. Write a Python function that implements binary search on a sorted list. Include unit tests that cover normal, boundary, and error cases.


Worked Examples

See the examples integrated throughout the sections above.

Common Pitfalls

  1. Choosing the wrong paradigm: OOP is not always the best choice. For data transformation tasks, functional programming may be cleaner.

  2. Ignoring non-functional requirements: Performance, security, and usability are as important as functionality.

  3. Insufficient testing: Boundary values are where most bugs occur. Always test at the edges of valid ranges.

  4. Poor encapsulation: Making all attributes public defeats the purpose of OOP. Use private attributes with getter/setter methods.

  5. Not handling exceptions: Programs should gracefully handle unexpected inputs without crashing.

  6. Confusing stack and queue operations. Stack is LIFO (push/pop from the same end). Queue is FIFO (enqueue at back, dequeue from front).

  7. Not validating inputs. Always check that inputs are within expected ranges and of the correct type before processing.

  8. Writing tests that only test the happy path. Edge cases and invalid inputs must also be tested.


Practice Questions

  1. Compare the waterfall and agile software development methodologies.

  2. Design a class diagram for a library management system with classes for Book, Member, and Loan.

  3. Write a Python function that implements a queue using a list, with enqueue and dequeue operations.

  4. Explain the four pillars of OOP with examples.

  5. Write a Haskell function that takes a list of integers and returns a new list with only the positive values.

  6. Describe three differences between black-box and white-box testing.

  7. Draw a use case diagram for an online shopping system with at least three actors and five use cases.

  8. Write pseudocode for a binary search algorithm and explain its time complexity.

  9. Explain the difference between functional and imperative programming paradigms. Give an example where each would be more appropriate.

  10. Write a Python class LinkedList with methods append``deleteAnd search. What is the time complexity of each operation?

  11. Write a Python function that validates a password according to the following rules: at least 8 characters, contains at least one uppercase letter, one lowercase letter, and one digit.

  12. Explain what is meant by test-driven development. Describe the cycle: red, green, refactor.

  13. A function calculateGrade(score) returns “A” for scores 70-100, “B” for 50-69, “C” for 40-49, and “Fail” for 0-39. Using boundary value analysis, identify all test cases.

  14. Write a Haskell function reverseList that reverses a list recursively. Prove that it terminates.

  15. Explain how inheritance promotes code reuse. Write a Python example with at least three levels of inheritance.

  16. Write pseudocode for a procedure that determines whether a string is a palindrome.

  17. Explain the difference between a syntax error, a logic error, and a runtime error. Give an example of each in Python.

  18. Describe three advantages and two disadvantages of agile development compared to the waterfall model.

Summary

This topic covers the core concepts of software design and development, including underlying theory, practical implementation, and key applications.

Key concepts include:

  • Big O notation and complexity analysis
  • searching algorithms (binary, linear)
  • sorting algorithms (bubble, merge, quick)
  • graph algorithms (Dijkstra, BFS, DFS)
  • dynamic programming

Understanding these concepts thoroughly is essential for both examinations and practical programming, and requires both theoretical knowledge and hands-on practice.